C10H12F2O — CID 178110962
3,3-difluoro-2,5-dihydrocyclohepta[b]furan;methane (PubChem CID 178110962) has the molecular formula C10H12F2O and a molecular weight of 186.20 g/mol. Its IUPAC name is 3,3-difluoro-2,5-dihydrocyclohepta[b]furan;methane.
| Compound Name | 3,3-difluoro-2,5-dihydrocyclohepta[b]furan;methane |
|---|---|
| PubChem CID | 178110962 |
| Molecular Formula | C10H12F2O |
| Molecular Weight | 186.20 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 3,3-difluoro-2,5-dihydrocyclohepta[b]furan;methane |
| SMILES | C.FC1(F)COC2=CC=CCC=C21 |
| InChI | InChI=1S/C9H8F2O.CH4/c10-9(11)6-12-8-5-3-1-2-4-7(8)9;/h1,3-5H,2,6H2;1H4 |
| InChIKey | GIJGEDNAMLTLGL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.20 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |