C13H26N2O2 — CID 178115937
1-(2,7-diazaspiro[3.5]nonan-2-yl)-2-ethoxyethanone;ethane (PubChem CID 178115937) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-(2,7-diazaspiro[3.5]nonan-2-yl)-2-ethoxyethanone;ethane.
| Compound Name | 1-(2,7-diazaspiro[3.5]nonan-2-yl)-2-ethoxyethanone;ethane |
|---|---|
| PubChem CID | 178115937 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1-(2,7-diazaspiro[3.5]nonan-2-yl)-2-ethoxyethanone;ethane |
| SMILES | CC.CCOCC(=O)N1CC2(CCNCC2)C1 |
| InChI | InChI=1S/C11H20N2O2.C2H6/c1-2-15-7-10(14)13-8-11(9-13)3-5-12-6-4-11;1-2/h12H,2-9H2,1H3;1-2H3 |
| InChIKey | RQVJZJQSZGDHRM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |