About 1-(2,7-diazaspiro[3.5]nonan-2-yl)-2-ethoxyethanone;ethane
1-(2,7-diazaspiro[3.5]nonan-2-yl)-2-ethoxyethanone;ethane (PubChem CID 178115937) has the molecular formula C13H26N2O2
and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-(2,7-diazaspiro[3.5]nonan-2-yl)-2-ethoxyethanone;ethane.
Molecular Properties
| Compound Name | 1-(2,7-diazaspiro[3.5]nonan-2-yl)-2-ethoxyethanone;ethane |
| PubChem CID | 178115937 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1-(2,7-diazaspiro[3.5]nonan-2-yl)-2-ethoxyethanone;ethane |
| SMILES | CC.CCOCC(=O)N1CC2(CCNCC2)C1 |
| InChI | InChI=1S/C11H20N2O2.C2H6/c1-2-15-7-10(14)13-8-11(9-13)3-5-12-6-4-11;1-2/h12H,2-9H2,1H3;1-2H3 |
| InChIKey | RQVJZJQSZGDHRM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,7-diazaspiro[3.5]nonan-2-yl)-2-ethoxyethanone;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,7-diazaspiro[3.5]nonan-2-yl)-2-ethoxyethanone;ethane?
The IUPAC name of 1-(2,7-diazaspiro[3.5]nonan-2-yl)-2-ethoxyethanone;ethane (CID 178115937) is 1-(2,7-diazaspiro[3.5]nonan-2-yl)-2-ethoxyethanone;ethane.
What is the SMILES notation for 1-(2,7-diazaspiro[3.5]nonan-2-yl)-2-ethoxyethanone;ethane?
The canonical SMILES for 1-(2,7-diazaspiro[3.5]nonan-2-yl)-2-ethoxyethanone;ethane is CC.CCOCC(=O)N1CC2(CCNCC2)C1.
What is the InChIKey of 1-(2,7-diazaspiro[3.5]nonan-2-yl)-2-ethoxyethanone;ethane?
The InChIKey is RQVJZJQSZGDHRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2.C2H6/c1-2-15-7-10(14)13-8-11(9-13)3-5-12-6-4-11;1-2/h12H,2-9H2,1H3;1-2H3.
What are the key properties of 1-(2,7-diazaspiro[3.5]nonan-2-yl)-2-ethoxyethanone;ethane?
1-(2,7-diazaspiro[3.5]nonan-2-yl)-2-ethoxyethanone;ethane has a molecular weight of 242.36 g/mol, XLogP of 1.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,7-diazaspiro[3.5]nonan-2-yl)-2-ethoxyethanone;ethane is sourced from PubChem (CID 178115937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).