About (4-benzylphenoxy) thiohypofluorite
(4-benzylphenoxy) thiohypofluorite (PubChem CID 178117006) has the molecular formula C13H11FOS
and a molecular weight of 234.30 g/mol. Its IUPAC name is (4-benzylphenoxy) thiohypofluorite.
Molecular Properties
| Compound Name | (4-benzylphenoxy) thiohypofluorite |
| PubChem CID | 178117006 |
| Molecular Formula | C13H11FOS |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | (4-benzylphenoxy) thiohypofluorite |
| SMILES | FSOc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H11FOS/c14-16-15-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | IARPJXXPCZKWKH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-benzylphenoxy) thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzylphenoxy) thiohypofluorite?
The IUPAC name of (4-benzylphenoxy) thiohypofluorite (CID 178117006) is (4-benzylphenoxy) thiohypofluorite.
What is the SMILES notation for (4-benzylphenoxy) thiohypofluorite?
The canonical SMILES for (4-benzylphenoxy) thiohypofluorite is FSOc1ccc(Cc2ccccc2)cc1.
What is the InChIKey of (4-benzylphenoxy) thiohypofluorite?
The InChIKey is IARPJXXPCZKWKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11FOS/c14-16-15-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10H2.
What are the key properties of (4-benzylphenoxy) thiohypofluorite?
(4-benzylphenoxy) thiohypofluorite has a molecular weight of 234.30 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzylphenoxy) thiohypofluorite is sourced from PubChem (CID 178117006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).