C28H45BN2OS — CID 178120230
CID 178120230 (PubChem CID 178120230) has the molecular formula C28H45BN2OS and a molecular weight of 468.56 g/mol.
| Compound Name | CID 178120230 |
|---|---|
| PubChem CID | 178120230 |
| Molecular Formula | C28H45BN2OS |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.33 |
| IUPAC Name | — |
| SMILES | [B]N1CCCC2OC3(CCC4C(=C(C)C3)CC3C4CCC4C[C@H](NSC)CCC43C)C(C)C21 |
| InChI | InChI=1S/C28H45BN2OS/c1-17-16-28(18(2)26-25(32-28)6-5-13-31(26)29)12-10-21-22-8-7-19-14-20(30-33-4)9-11-27(19,3)24(22)15-23(17)21/h18-22,24-26,30H,5-16H2,1-4H3/t18?,19?,20-,21?,22?,24?,25?,26?,27?,28?/m1/s1 |
| InChIKey | ZGPBJZWUIYPQHA-GTGAWSCRSA-N |
| XLogP | 5.90 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|