C25H20FN7O2 — CID 178120522
4-(2-fluoro-4-nitrophenyl)-6,7-dimethyl-2-[3-methyl-5-(1-methylpyrazol-4-yl)phenyl]pteridine (PubChem CID 178120522) has the molecular formula C25H20FN7O2 and a molecular weight of 469.48 g/mol. Its IUPAC name is 4-(2-fluoro-4-nitrophenyl)-6,7-dimethyl-2-[3-methyl-5-(1-methylpyrazol-4-yl)phenyl]pteridine.
| Compound Name | 4-(2-fluoro-4-nitrophenyl)-6,7-dimethyl-2-[3-methyl-5-(1-methylpyrazol-4-yl)phenyl]pteridine |
|---|---|
| PubChem CID | 178120522 |
| Molecular Formula | C25H20FN7O2 |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 4-(2-fluoro-4-nitrophenyl)-6,7-dimethyl-2-[3-methyl-5-(1-methylpyrazol-4-yl)phenyl]pteridine |
| SMILES | Cc1cc(-c2cnn(C)c2)cc(-c2nc(-c3ccc([N+](=O)[O-])cc3F)c3nc(C)c(C)nc3n2)c1 |
| InChI | InChI=1S/C25H20FN7O2/c1-13-7-16(18-11-27-32(4)12-18)9-17(8-13)24-30-22(20-6-5-19(33(34)35)10-21(20)26)23-25(31-24)29-15(3)14(2)28-23/h5-12H,1-4H3 |
| InChIKey | VKCOLPVWFLBNAU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|