C10H8N4O4 — CID 121277839
4-(3,5-dinitrophenyl)-1-methylpyrazole (PubChem CID 121277839) has the molecular formula C10H8N4O4 and a molecular weight of 248.20 g/mol. Its IUPAC name is 4-(3,5-dinitrophenyl)-1-methylpyrazole.
| Compound Name | 4-(3,5-dinitrophenyl)-1-methylpyrazole |
|---|---|
| PubChem CID | 121277839 |
| Molecular Formula | C10H8N4O4 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 4-(3,5-dinitrophenyl)-1-methylpyrazole |
| SMILES | Cn1cc(-c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cn1 |
| InChI | InChI=1S/C10H8N4O4/c1-12-6-8(5-11-12)7-2-9(13(15)16)4-10(3-7)14(17)18/h2-6H,1H3 |
| InChIKey | CUOREDDYTQNATJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 104.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|