C10H8N6O2 — CID 67053225
2-(1-methylpyrazol-4-yl)-6-nitropyrazolo[1,5-a]pyrimidine (PubChem CID 67053225) has the molecular formula C10H8N6O2 and a molecular weight of 244.21 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)-6-nitropyrazolo[1,5-a]pyrimidine.
| Compound Name | 2-(1-methylpyrazol-4-yl)-6-nitropyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 67053225 |
| Molecular Formula | C10H8N6O2 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-(1-methylpyrazol-4-yl)-6-nitropyrazolo[1,5-a]pyrimidine |
| SMILES | Cn1cc(-c2cc3ncc([N+](=O)[O-])cn3n2)cn1 |
| InChI | InChI=1S/C10H8N6O2/c1-14-5-7(3-12-14)9-2-10-11-4-8(16(17)18)6-15(10)13-9/h2-6H,1H3 |
| InChIKey | WBXYGQRPUFDIIE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|