C20H11N5O4 — CID 156767564
4-[6-(2-hydroxy-5-nitrobenzoyl)pyrazolo[1,5-a]pyrimidin-2-yl]benzonitrile (PubChem CID 156767564) has the molecular formula C20H11N5O4 and a molecular weight of 385.34 g/mol. Its IUPAC name is 4-[6-(2-hydroxy-5-nitrobenzoyl)pyrazolo[1,5-a]pyrimidin-2-yl]benzonitrile.
| Compound Name | 4-[6-(2-hydroxy-5-nitrobenzoyl)pyrazolo[1,5-a]pyrimidin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 156767564 |
| Molecular Formula | C20H11N5O4 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 4-[6-(2-hydroxy-5-nitrobenzoyl)pyrazolo[1,5-a]pyrimidin-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc3ncc(C(=O)c4cc([N+](=O)[O-])ccc4O)cn3n2)cc1 |
| InChI | InChI=1S/C20H11N5O4/c21-9-12-1-3-13(4-2-12)17-8-19-22-10-14(11-24(19)23-17)20(27)16-7-15(25(28)29)5-6-18(16)26/h1-8,10-11,26H |
| InChIKey | ZJNRLORQFCDJAY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|