C20H14N4O4 — CID 156767550
(2-hydroxy-5-nitrophenyl)-[2-(3-methylphenyl)pyrazolo[1,5-a]pyrimidin-6-yl]methanone (PubChem CID 156767550) has the molecular formula C20H14N4O4 and a molecular weight of 374.36 g/mol. Its IUPAC name is (2-hydroxy-5-nitrophenyl)-[2-(3-methylphenyl)pyrazolo[1,5-a]pyrimidin-6-yl]methanone.
| Compound Name | (2-hydroxy-5-nitrophenyl)-[2-(3-methylphenyl)pyrazolo[1,5-a]pyrimidin-6-yl]methanone |
|---|---|
| PubChem CID | 156767550 |
| Molecular Formula | C20H14N4O4 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | (2-hydroxy-5-nitrophenyl)-[2-(3-methylphenyl)pyrazolo[1,5-a]pyrimidin-6-yl]methanone |
| SMILES | Cc1cccc(-c2cc3ncc(C(=O)c4cc([N+](=O)[O-])ccc4O)cn3n2)c1 |
| InChI | InChI=1S/C20H14N4O4/c1-12-3-2-4-13(7-12)17-9-19-21-10-14(11-23(19)22-17)20(26)16-8-15(24(27)28)5-6-18(16)25/h2-11,25H,1H3 |
| InChIKey | ICYYNBQMHCTFJD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|