C22H17ClF7N5 — CID 178121108
(1R,3S,4S)-2-[4,6-bis(trifluoromethyl)-2-pyridinyl]-3-[4-(3-chloro-4-fluorophenyl)-5-methyl-1,2,4-triazol-3-yl]-2-azabicyclo[2.2.1]heptane (PubChem CID 178121108) has the molecular formula C22H17ClF7N5 and a molecular weight of 519.85 g/mol. Its IUPAC name is (1R,3S,4S)-2-[4,6-bis(trifluoromethyl)-2-pyridinyl]-3-[4-(3-chloro-4-fluorophenyl)-5-methyl-1,2,4-triazol-3-yl]-2-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,3S,4S)-2-[4,6-bis(trifluoromethyl)-2-pyridinyl]-3-[4-(3-chloro-4-fluorophenyl)-5-methyl-1,2,4-triazol-3-yl]-2-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 178121108 |
| Molecular Formula | C22H17ClF7N5 |
| Molecular Weight | 519.85 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | (1R,3S,4S)-2-[4,6-bis(trifluoromethyl)-2-pyridinyl]-3-[4-(3-chloro-4-fluorophenyl)-5-methyl-1,2,4-triazol-3-yl]-2-azabicyclo[2.2.1]heptane |
| SMILES | Cc1nnc([C@@H]2[C@H]3CC[C@H](C3)N2c2cc(C(F)(F)F)cc(C(F)(F)F)n2)n1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C22H17ClF7N5/c1-10-32-33-20(34(10)14-4-5-16(24)15(23)9-14)19-11-2-3-13(6-11)35(19)18-8-12(21(25,26)27)7-17(31-18)22(28,29)30/h4-5,7-9,11,13,19H,2-3,6H2,1H3/t11-,13+,19-/m0/s1 |
| InChIKey | OAYCQCXSMLZOIK-XAEJFWIOSA-N |
| XLogP | 6.53 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.85 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |