C26H32BN5O4 — CID 178122398
N-[8-[(4-methoxyphenyl)methyl-methylamino]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[3,4-c]pyridazin-3-yl]cyclopropanecarboxamide (PubChem CID 178122398) has the molecular formula C26H32BN5O4 and a molecular weight of 489.39 g/mol. Its IUPAC name is N-[8-[(4-methoxyphenyl)methyl-methylamino]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[3,4-c]pyridazin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[8-[(4-methoxyphenyl)methyl-methylamino]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[3,4-c]pyridazin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 178122398 |
| Molecular Formula | C26H32BN5O4 |
| Molecular Weight | 489.39 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | N-[8-[(4-methoxyphenyl)methyl-methylamino]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[3,4-c]pyridazin-3-yl]cyclopropanecarboxamide |
| SMILES | COc1ccc(CN(C)c2ncc(B3OC(C)(C)C(C)(C)O3)c3cc(NC(=O)C4CC4)nnc23)cc1 |
| InChI | InChI=1S/C26H32BN5O4/c1-25(2)26(3,4)36-27(35-25)20-14-28-23(32(5)15-16-7-11-18(34-6)12-8-16)22-19(20)13-21(30-31-22)29-24(33)17-9-10-17/h7-8,11-14,17H,9-10,15H2,1-6H3,(H,29,30,33) |
| InChIKey | NZVVEUDSDBHMOV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|