C14H19BrN2 — CID 178122769
3-[(4-bromophenyl)methyl]-3,7-diazabicyclo[3.3.1]nonane (PubChem CID 178122769) has the molecular formula C14H19BrN2 and a molecular weight of 295.22 g/mol. Its IUPAC name is 3-[(4-bromophenyl)methyl]-3,7-diazabicyclo[3.3.1]nonane.
| Compound Name | 3-[(4-bromophenyl)methyl]-3,7-diazabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 178122769 |
| Molecular Formula | C14H19BrN2 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 3-[(4-bromophenyl)methyl]-3,7-diazabicyclo[3.3.1]nonane |
| SMILES | Brc1ccc(CN2CC3CNCC(C3)C2)cc1 |
| InChI | InChI=1S/C14H19BrN2/c15-14-3-1-11(2-4-14)8-17-9-12-5-13(10-17)7-16-6-12/h1-4,12-13,16H,5-10H2 |
| InChIKey | AYTKETLWYGRVET-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |