C20H20N8O2 — CID 178122833
cis-(1S,2R)-N-[5-(6-methoxy-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-8-(methylamino)pyrido[3,4-c]pyridazin-3-yl]-2-methylcyclopropane-1-carboxamide (PubChem CID 178122833) has the molecular formula C20H20N8O2 and a molecular weight of 404.43 g/mol. Its IUPAC name is cis-(1S,2R)-N-[5-(6-methoxy-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-8-(methylamino)pyrido[3,4-c]pyridazin-3-yl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-[5-(6-methoxy-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-8-(methylamino)pyrido[3,4-c]pyridazin-3-yl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 178122833 |
| Molecular Formula | C20H20N8O2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | cis-(1S,2R)-N-[5-(6-methoxy-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-8-(methylamino)pyrido[3,4-c]pyridazin-3-yl]-2-methylcyclopropane-1-carboxamide |
| SMILES | CNc1ncc(-c2nc3ccc(OC)cn3n2)c2cc(NC(=O)[C@H]3C[C@H]3C)nnc12 |
| InChI | InChI=1S/C20H20N8O2/c1-10-6-12(10)20(29)23-15-7-13-14(8-22-19(21-2)17(13)26-25-15)18-24-16-5-4-11(30-3)9-28(16)27-18/h4-5,7-10,12H,6H2,1-3H3,(H,21,22)(H,23,25,29)/t10-,12+/m1/s1 |
| InChIKey | MOONHHPFKPVRTR-PWSUYJOCSA-N |
| XLogP | 2.38 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |