C24H27N9O2 — CID 178121785
trans-(1R,2S)-2-ethyl-N-[5-(6-morpholin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-8-(trideuteriomethylamino)pyrido[3,4-c]pyridazin-3-yl]cyclopropane-1-carboxamide (PubChem CID 178121785) has the molecular formula C24H27N9O2 and a molecular weight of 476.56 g/mol. Its IUPAC name is trans-(1R,2S)-2-ethyl-N-[5-(6-morpholin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-8-(trideuteriomethylamino)pyrido[3,4-c]pyridazin-3-yl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2S)-2-ethyl-N-[5-(6-morpholin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-8-(trideuteriomethylamino)pyrido[3,4-c]pyridazin-3-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 178121785 |
| Molecular Formula | C24H27N9O2 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | trans-(1R,2S)-2-ethyl-N-[5-(6-morpholin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-8-(trideuteriomethylamino)pyrido[3,4-c]pyridazin-3-yl]cyclopropane-1-carboxamide |
| SMILES | [2H]C([2H])([2H])Nc1ncc(-c2nc3ccc(N4CCOCC4)cn3n2)c2cc(NC(=O)[C@@H]3C[C@@H]3CC)nnc12 |
| InChI | InChI=1S/C24H27N9O2/c1-3-14-10-16(14)24(34)27-19-11-17-18(12-26-23(25-2)21(17)30-29-19)22-28-20-5-4-15(13-33(20)31-22)32-6-8-35-9-7-32/h4-5,11-14,16H,3,6-10H2,1-2H3,(H,25,26)(H,27,29,34)/t14-,16+/m0/s1/i2D3 |
| InChIKey | IQMCOTNIEMNQHI-SMIVJJTOSA-N |
| XLogP | 2.60 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |