C25H27N7O2 — CID 178122906
cis-(1S,2R)-2-methyl-N-[5-(6-morpholin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-8-(1,1,2,2,2-pentadeuterioethyl)-2,7-naphthyridin-3-yl]cyclopropane-1-carboxamide (PubChem CID 178122906) has the molecular formula C25H27N7O2 and a molecular weight of 462.57 g/mol. Its IUPAC name is cis-(1S,2R)-2-methyl-N-[5-(6-morpholin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-8-(1,1,2,2,2-pentadeuterioethyl)-2,7-naphthyridin-3-yl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-2-methyl-N-[5-(6-morpholin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-8-(1,1,2,2,2-pentadeuterioethyl)-2,7-naphthyridin-3-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 178122906 |
| Molecular Formula | C25H27N7O2 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | cis-(1S,2R)-2-methyl-N-[5-(6-morpholin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-8-(1,1,2,2,2-pentadeuterioethyl)-2,7-naphthyridin-3-yl]cyclopropane-1-carboxamide |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])c1ncc(-c2nc3ccc(N4CCOCC4)cn3n2)c2cc(NC(=O)[C@H]3C[C@H]3C)ncc12 |
| InChI | InChI=1S/C25H27N7O2/c1-3-21-19-12-27-22(28-25(33)17-10-15(17)2)11-18(19)20(13-26-21)24-29-23-5-4-16(14-32(23)30-24)31-6-8-34-9-7-31/h4-5,11-15,17H,3,6-10H2,1-2H3,(H,27,28,33)/t15-,17+/m1/s1/i1D3,3D2 |
| InChIKey | LAEYMSLMGSCWCL-VPXKPQPHSA-N |
| XLogP | 3.33 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |