C25H28N8O2 — CID 170677805
N-[8-(1,1-dideuterioethylamino)-5-(6-morpholin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-2,7-naphthyridin-3-yl]-2-methylcyclopropane-1-carboxamide (PubChem CID 170677805) has the molecular formula C25H28N8O2 and a molecular weight of 474.57 g/mol. Its IUPAC name is N-[8-(1,1-dideuterioethylamino)-5-(6-morpholin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-2,7-naphthyridin-3-yl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | N-[8-(1,1-dideuterioethylamino)-5-(6-morpholin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-2,7-naphthyridin-3-yl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 170677805 |
| Molecular Formula | C25H28N8O2 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | N-[8-(1,1-dideuterioethylamino)-5-(6-morpholin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-2,7-naphthyridin-3-yl]-2-methylcyclopropane-1-carboxamide |
| SMILES | [2H]C([2H])(C)Nc1ncc(-c2nc3ccc(N4CCOCC4)cn3n2)c2cc(NC(=O)C3CC3C)ncc12 |
| InChI | InChI=1S/C25H28N8O2/c1-3-26-23-19-12-27-21(29-25(34)17-10-15(17)2)11-18(19)20(13-28-23)24-30-22-5-4-16(14-33(22)31-24)32-6-8-35-9-7-32/h4-5,11-15,17H,3,6-10H2,1-2H3,(H,26,28)(H,27,29,34)/i3D2 |
| InChIKey | YIQPQPJNRMJOQX-SMZGMGDZSA-N |
| XLogP | 3.20 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |