C17H27FN4 — CID 178123160
ethane;3-fluoro-N-(1H-imidazol-5-ylmethyl)-2-(methylaminomethyl)-N-propan-2-ylaniline (PubChem CID 178123160) has the molecular formula C17H27FN4 and a molecular weight of 306.43 g/mol. Its IUPAC name is ethane;3-fluoro-N-(1H-imidazol-5-ylmethyl)-2-(methylaminomethyl)-N-propan-2-ylaniline.
| Compound Name | ethane;3-fluoro-N-(1H-imidazol-5-ylmethyl)-2-(methylaminomethyl)-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 178123160 |
| Molecular Formula | C17H27FN4 |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | ethane;3-fluoro-N-(1H-imidazol-5-ylmethyl)-2-(methylaminomethyl)-N-propan-2-ylaniline |
| SMILES | CC.CNCc1c(F)cccc1N(Cc1cnc[nH]1)C(C)C |
| InChI | InChI=1S/C15H21FN4.C2H6/c1-11(2)20(9-12-7-18-10-19-12)15-6-4-5-14(16)13(15)8-17-3;1-2/h4-7,10-11,17H,8-9H2,1-3H3,(H,18,19);1-2H3 |
| InChIKey | OISGHTKMDSDQRS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |