C13H15F2N3 — CID 114058190
1-(2,3-difluorophenyl)-N-[2-(1H-imidazol-5-yl)ethyl]ethanamine (PubChem CID 114058190) has the molecular formula C13H15F2N3 and a molecular weight of 251.28 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-N-[2-(1H-imidazol-5-yl)ethyl]ethanamine.
| Compound Name | 1-(2,3-difluorophenyl)-N-[2-(1H-imidazol-5-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 114058190 |
| Molecular Formula | C13H15F2N3 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 1-(2,3-difluorophenyl)-N-[2-(1H-imidazol-5-yl)ethyl]ethanamine |
| SMILES | CC(NCCc1cnc[nH]1)c1cccc(F)c1F |
| InChI | InChI=1S/C13H15F2N3/c1-9(11-3-2-4-12(14)13(11)15)17-6-5-10-7-16-8-18-10/h2-4,7-9,17H,5-6H2,1H3,(H,16,18) |
| InChIKey | LQPXVBPTBMFTOM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |