C20H14BrF3N2O3Se — CID 178125580
4-[3-[8-bromo-3-(trifluoromethylselanyl)indolizin-2-yl]prop-2-ynylamino]-3-methoxybenzoic acid (PubChem CID 178125580) has the molecular formula C20H14BrF3N2O3Se and a molecular weight of 546.20 g/mol. Its IUPAC name is 4-[3-[8-bromo-3-(trifluoromethylselanyl)indolizin-2-yl]prop-2-ynylamino]-3-methoxybenzoic acid.
| Compound Name | 4-[3-[8-bromo-3-(trifluoromethylselanyl)indolizin-2-yl]prop-2-ynylamino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 178125580 |
| Molecular Formula | C20H14BrF3N2O3Se |
| Molecular Weight | 546.20 g/mol |
| Exact Mass | 545.93 |
| IUPAC Name | 4-[3-[8-bromo-3-(trifluoromethylselanyl)indolizin-2-yl]prop-2-ynylamino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NCC#Cc1cc2c(Br)cccn2c1[Se]C(F)(F)F |
| InChI | InChI=1S/C20H14BrF3N2O3Se/c1-29-17-11-13(19(27)28)6-7-15(17)25-8-2-4-12-10-16-14(21)5-3-9-26(16)18(12)30-20(22,23)24/h3,5-7,9-11,25H,8H2,1H3,(H,27,28) |
| InChIKey | YAEPJLNAFDQLCF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.20 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|