C20H16BrF3N4O2 — CID 171531471
4-[3-[8-bromo-3-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide (PubChem CID 171531471) has the molecular formula C20H16BrF3N4O2 and a molecular weight of 481.27 g/mol. Its IUPAC name is 4-[3-[8-bromo-3-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide.
| Compound Name | 4-[3-[8-bromo-3-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 171531471 |
| Molecular Formula | C20H16BrF3N4O2 |
| Molecular Weight | 481.27 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | 4-[3-[8-bromo-3-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(NCC#Cc2nc3c(Br)cccn3c2C(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C20H16BrF3N4O2/c1-25-19(29)12-7-8-14(16(11-12)30-2)26-9-3-6-15-17(20(22,23)24)28-10-4-5-13(21)18(28)27-15/h4-5,7-8,10-11,26H,9H2,1-2H3,(H,25,29) |
| InChIKey | IPZHBYMVEVIDHU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|