C20H17BrN2O2S — CID 175555472
4-[3-(4-bromo-1-benzothiophen-2-yl)prop-2-ynylamino]-3-methoxy-N-methylbenzamide (PubChem CID 175555472) has the molecular formula C20H17BrN2O2S and a molecular weight of 429.34 g/mol. Its IUPAC name is 4-[3-(4-bromo-1-benzothiophen-2-yl)prop-2-ynylamino]-3-methoxy-N-methylbenzamide.
| Compound Name | 4-[3-(4-bromo-1-benzothiophen-2-yl)prop-2-ynylamino]-3-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 175555472 |
| Molecular Formula | C20H17BrN2O2S |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 4-[3-(4-bromo-1-benzothiophen-2-yl)prop-2-ynylamino]-3-methoxy-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(NCC#Cc2cc3c(Br)cccc3s2)c(OC)c1 |
| InChI | InChI=1S/C20H17BrN2O2S/c1-22-20(24)13-8-9-17(18(11-13)25-2)23-10-4-5-14-12-15-16(21)6-3-7-19(15)26-14/h3,6-9,11-12,23H,10H2,1-2H3,(H,22,24) |
| InChIKey | VCQYMZWVNSKDAZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|