C30H35F3IN5O2 — CID 170250328
4-[3-[4-[[1-iodo-4-methyl-4-(methylamino)cyclohexyl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide (PubChem CID 170250328) has the molecular formula C30H35F3IN5O2 and a molecular weight of 681.54 g/mol. Its IUPAC name is 4-[3-[4-[[1-iodo-4-methyl-4-(methylamino)cyclohexyl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide.
| Compound Name | 4-[3-[4-[[1-iodo-4-methyl-4-(methylamino)cyclohexyl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 170250328 |
| Molecular Formula | C30H35F3IN5O2 |
| Molecular Weight | 681.54 g/mol |
| Exact Mass | 681.18 |
| IUPAC Name | 4-[3-[4-[[1-iodo-4-methyl-4-(methylamino)cyclohexyl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(NCC#Cc2cc3c(NC4(I)CCC(C)(NC)CC4)cccc3n2CC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C30H35F3IN5O2/c1-28(36-3)12-14-29(34,15-13-28)38-23-8-5-9-25-22(23)18-21(39(25)19-30(31,32)33)7-6-16-37-24-11-10-20(27(40)35-2)17-26(24)41-4/h5,8-11,17-18,36-38H,12-16,19H2,1-4H3,(H,35,40) |
| InChIKey | HIBPDKZYVZSNRV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.54 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|