C34H40F3N5O5 — CID 166555104
methyl 6-[4-[[2-[3-[2-methoxy-4-(methylcarbamoyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]-6-oxohexanoate (PubChem CID 166555104) has the molecular formula C34H40F3N5O5 and a molecular weight of 655.72 g/mol. Its IUPAC name is methyl 6-[4-[[2-[3-[2-methoxy-4-(methylcarbamoyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]-6-oxohexanoate.
| Compound Name | methyl 6-[4-[[2-[3-[2-methoxy-4-(methylcarbamoyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]-6-oxohexanoate |
|---|---|
| PubChem CID | 166555104 |
| Molecular Formula | C34H40F3N5O5 |
| Molecular Weight | 655.72 g/mol |
| Exact Mass | 655.30 |
| IUPAC Name | methyl 6-[4-[[2-[3-[2-methoxy-4-(methylcarbamoyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]-6-oxohexanoate |
| SMILES | CNC(=O)c1ccc(NCC#Cc2cc3c(NC4CCN(C(=O)CCCCC(=O)OC)CC4)cccc3n2CC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C34H40F3N5O5/c1-38-33(45)23-13-14-28(30(20-23)46-2)39-17-7-8-25-21-26-27(9-6-10-29(26)42(25)22-34(35,36)37)40-24-15-18-41(19-16-24)31(43)11-4-5-12-32(44)47-3/h6,9-10,13-14,20-21,24,39-40H,4-5,11-12,15-19,22H2,1-3H3,(H,38,45) |
| InChIKey | ZUUGYAWKQGORPS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.72 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|