C33H41FIN5O3 — CID 170250805
4-[3-[1-(2-fluoroethyl)-4-[(1-iodo-4-methyl-4-morpholin-4-ylcyclohexyl)amino]indol-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide (PubChem CID 170250805) has the molecular formula C33H41FIN5O3 and a molecular weight of 701.62 g/mol. Its IUPAC name is 4-[3-[1-(2-fluoroethyl)-4-[(1-iodo-4-methyl-4-morpholin-4-ylcyclohexyl)amino]indol-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide.
| Compound Name | 4-[3-[1-(2-fluoroethyl)-4-[(1-iodo-4-methyl-4-morpholin-4-ylcyclohexyl)amino]indol-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 170250805 |
| Molecular Formula | C33H41FIN5O3 |
| Molecular Weight | 701.62 g/mol |
| Exact Mass | 701.22 |
| IUPAC Name | 4-[3-[1-(2-fluoroethyl)-4-[(1-iodo-4-methyl-4-morpholin-4-ylcyclohexyl)amino]indol-2-yl]prop-2-ynylamino]-3-methoxy-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(NCC#Cc2cc3c(NC4(I)CCC(C)(N5CCOCC5)CC4)cccc3n2CCF)c(OC)c1 |
| InChI | InChI=1S/C33H41FIN5O3/c1-32(39-18-20-43-21-19-39)11-13-33(35,14-12-32)38-27-7-4-8-29-26(27)23-25(40(29)17-15-34)6-5-16-37-28-10-9-24(31(41)36-2)22-30(28)42-3/h4,7-10,22-23,37-38H,11-21H2,1-3H3,(H,36,41) |
| InChIKey | LCIVRIMWYBJNGI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.62 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|