C32H38IN5O4S — CID 170250800
2-[4-[(1-iodo-4-methyl-4-morpholin-4-ylcyclohexyl)amino]-2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]indol-1-yl]acetonitrile (PubChem CID 170250800) has the molecular formula C32H38IN5O4S and a molecular weight of 715.66 g/mol. Its IUPAC name is 2-[4-[(1-iodo-4-methyl-4-morpholin-4-ylcyclohexyl)amino]-2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]indol-1-yl]acetonitrile.
| Compound Name | 2-[4-[(1-iodo-4-methyl-4-morpholin-4-ylcyclohexyl)amino]-2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]indol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 170250800 |
| Molecular Formula | C32H38IN5O4S |
| Molecular Weight | 715.66 g/mol |
| Exact Mass | 715.17 |
| IUPAC Name | 2-[4-[(1-iodo-4-methyl-4-morpholin-4-ylcyclohexyl)amino]-2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]indol-1-yl]acetonitrile |
| SMILES | COc1cc(S(C)(=O)=O)ccc1NCC#Cc1cc2c(NC3(I)CCC(C)(N4CCOCC4)CC3)cccc2n1CC#N |
| InChI | InChI=1S/C32H38IN5O4S/c1-31(37-18-20-42-21-19-37)11-13-32(33,14-12-31)36-27-7-4-8-29-26(27)22-24(38(29)17-15-34)6-5-16-35-28-10-9-25(43(3,39)40)23-30(28)41-2/h4,7-10,22-23,35-36H,11-14,16-21H2,1-3H3 |
| InChIKey | LLHNKEOBLQODIN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.66 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|