About 3-(3-fluoro-4-propan-2-ylpiperidin-1-yl)thietane 1,1-dioxide
3-(3-fluoro-4-propan-2-ylpiperidin-1-yl)thietane 1,1-dioxide (PubChem CID 178125875) has the molecular formula C11H20FNO2S
and a molecular weight of 249.35 g/mol. Its IUPAC name is 3-(3-fluoro-4-propan-2-ylpiperidin-1-yl)thietane 1,1-dioxide.
Analyze 3-(3-fluoro-4-propan-2-ylpiperidin-1-yl)thietane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-fluoro-4-propan-2-ylpiperidin-1-yl)thietane 1,1-dioxide?
The IUPAC name of 3-(3-fluoro-4-propan-2-ylpiperidin-1-yl)thietane 1,1-dioxide (CID 178125875) is 3-(3-fluoro-4-propan-2-ylpiperidin-1-yl)thietane 1,1-dioxide.
What is the SMILES notation for 3-(3-fluoro-4-propan-2-ylpiperidin-1-yl)thietane 1,1-dioxide?
The canonical SMILES for 3-(3-fluoro-4-propan-2-ylpiperidin-1-yl)thietane 1,1-dioxide is CC(C)C1CCN(C2CS(=O)(=O)C2)CC1F.
What is the InChIKey of 3-(3-fluoro-4-propan-2-ylpiperidin-1-yl)thietane 1,1-dioxide?
The InChIKey is DOVFKNBQELGVPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20FNO2S/c1-8(2)10-3-4-13(5-11(10)12)9-6-16(14,15)7-9/h8-11H,3-7H2,1-2H3.
What are the key properties of 3-(3-fluoro-4-propan-2-ylpiperidin-1-yl)thietane 1,1-dioxide?
3-(3-fluoro-4-propan-2-ylpiperidin-1-yl)thietane 1,1-dioxide has a molecular weight of 249.35 g/mol, XLogP of 1.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-fluoro-4-propan-2-ylpiperidin-1-yl)thietane 1,1-dioxide is sourced from PubChem (CID 178125875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).