About 1-tert-butyl-1-methylcyclobutane;2-methylpropane
1-tert-butyl-1-methylcyclobutane;2-methylpropane (PubChem CID 178126062) has the molecular formula C13H28
and a molecular weight of 184.37 g/mol. Its IUPAC name is 1-tert-butyl-1-methylcyclobutane;2-methylpropane.
Molecular Properties
| Compound Name | 1-tert-butyl-1-methylcyclobutane;2-methylpropane |
| PubChem CID | 178126062 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | 1-tert-butyl-1-methylcyclobutane;2-methylpropane |
| SMILES | CC(C)(C)C1(C)CCC1.CC(C)C |
| InChI | InChI=1S/C9H18.C4H10/c1-8(2,3)9(4)6-5-7-9;1-4(2)3/h5-7H2,1-4H3;4H,1-3H3 |
| InChIKey | JMBGJVOITOFMQH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-tert-butyl-1-methylcyclobutane;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-1-methylcyclobutane;2-methylpropane?
The IUPAC name of 1-tert-butyl-1-methylcyclobutane;2-methylpropane (CID 178126062) is 1-tert-butyl-1-methylcyclobutane;2-methylpropane.
What is the SMILES notation for 1-tert-butyl-1-methylcyclobutane;2-methylpropane?
The canonical SMILES for 1-tert-butyl-1-methylcyclobutane;2-methylpropane is CC(C)(C)C1(C)CCC1.CC(C)C.
What is the InChIKey of 1-tert-butyl-1-methylcyclobutane;2-methylpropane?
The InChIKey is JMBGJVOITOFMQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C4H10/c1-8(2,3)9(4)6-5-7-9;1-4(2)3/h5-7H2,1-4H3;4H,1-3H3.
What are the key properties of 1-tert-butyl-1-methylcyclobutane;2-methylpropane?
1-tert-butyl-1-methylcyclobutane;2-methylpropane has a molecular weight of 184.37 g/mol, XLogP of 4.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-1-methylcyclobutane;2-methylpropane is sourced from PubChem (CID 178126062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).