C15H21F3N4O3 — CID 178126842
1-(azetidin-1-yl)-2-[[6-(oxan-4-yl)pyrimidin-4-yl]amino]ethanone;trifluoromethanol (PubChem CID 178126842) has the molecular formula C15H21F3N4O3 and a molecular weight of 362.35 g/mol. Its IUPAC name is 1-(azetidin-1-yl)-2-[[6-(oxan-4-yl)pyrimidin-4-yl]amino]ethanone;trifluoromethanol.
| Compound Name | 1-(azetidin-1-yl)-2-[[6-(oxan-4-yl)pyrimidin-4-yl]amino]ethanone;trifluoromethanol |
|---|---|
| PubChem CID | 178126842 |
| Molecular Formula | C15H21F3N4O3 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1-(azetidin-1-yl)-2-[[6-(oxan-4-yl)pyrimidin-4-yl]amino]ethanone;trifluoromethanol |
| SMILES | O=C(CNc1cc(C2CCOCC2)ncn1)N1CCC1.OC(F)(F)F |
| InChI | InChI=1S/C14H20N4O2.CHF3O/c19-14(18-4-1-5-18)9-15-13-8-12(16-10-17-13)11-2-6-20-7-3-11;2-1(3,4)5/h8,10-11H,1-7,9H2,(H,15,16,17);5H |
| InChIKey | XSIXKMVCRUZSFI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |