C19H30F4N4O2 — CID 178127069
(2R)-1-(azetidin-1-yl)-2-[(5-fluoro-6-propylpyrimidin-4-yl)amino]propan-1-one;(E)-pent-2-ene;trifluoromethanol (PubChem CID 178127069) has the molecular formula C19H30F4N4O2 and a molecular weight of 422.47 g/mol. Its IUPAC name is (2R)-1-(azetidin-1-yl)-2-[(5-fluoro-6-propylpyrimidin-4-yl)amino]propan-1-one;(E)-pent-2-ene;trifluoromethanol.
| Compound Name | (2R)-1-(azetidin-1-yl)-2-[(5-fluoro-6-propylpyrimidin-4-yl)amino]propan-1-one;(E)-pent-2-ene;trifluoromethanol |
|---|---|
| PubChem CID | 178127069 |
| Molecular Formula | C19H30F4N4O2 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (2R)-1-(azetidin-1-yl)-2-[(5-fluoro-6-propylpyrimidin-4-yl)amino]propan-1-one;(E)-pent-2-ene;trifluoromethanol |
| SMILES | C/C=C/CC.CCCc1ncnc(N[C@H](C)C(=O)N2CCC2)c1F.OC(F)(F)F |
| InChI | InChI=1S/C13H19FN4O.C5H10.CHF3O/c1-3-5-10-11(14)12(16-8-15-10)17-9(2)13(19)18-6-4-7-18;1-3-5-4-2;2-1(3,4)5/h8-9H,3-7H2,1-2H3,(H,15,16,17);3,5H,4H2,1-2H3;5H/b;5-3+;/t9-;;/m1../s1 |
| InChIKey | IZSNUALHMQIHDN-QBKVJIDBSA-N |
| XLogP | 4.07 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|