C16H23F3N4O2S — CID 178126624
1,1-difluoroethanol;(2R)-2-[[6-(3-fluorobut-3-enyl)-2-methylpyrimidin-4-yl]amino]-1-(thiazetidin-2-yl)propan-1-one (PubChem CID 178126624) has the molecular formula C16H23F3N4O2S and a molecular weight of 392.45 g/mol. Its IUPAC name is 1,1-difluoroethanol;(2R)-2-[[6-(3-fluorobut-3-enyl)-2-methylpyrimidin-4-yl]amino]-1-(thiazetidin-2-yl)propan-1-one.
| Compound Name | 1,1-difluoroethanol;(2R)-2-[[6-(3-fluorobut-3-enyl)-2-methylpyrimidin-4-yl]amino]-1-(thiazetidin-2-yl)propan-1-one |
|---|---|
| PubChem CID | 178126624 |
| Molecular Formula | C16H23F3N4O2S |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1,1-difluoroethanol;(2R)-2-[[6-(3-fluorobut-3-enyl)-2-methylpyrimidin-4-yl]amino]-1-(thiazetidin-2-yl)propan-1-one |
| SMILES | C=C(F)CCc1cc(N[C@H](C)C(=O)N2CCS2)nc(C)n1.CC(O)(F)F |
| InChI | InChI=1S/C14H19FN4OS.C2H4F2O/c1-9(15)4-5-12-8-13(18-11(3)17-12)16-10(2)14(20)19-6-7-21-19;1-2(3,4)5/h8,10H,1,4-7H2,2-3H3,(H,16,17,18);5H,1H3/t10-;/m1./s1 |
| InChIKey | PRVQHGFURINYAF-HNCPQSOCSA-N |
| XLogP | 3.08 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|