C15H21F3N4O2 — CID 178126812
(2R)-1-(azetidin-1-yl)-2-[(6-but-3-enylpyrimidin-4-yl)amino]propan-1-one;trifluoromethanol (PubChem CID 178126812) has the molecular formula C15H21F3N4O2 and a molecular weight of 346.35 g/mol. Its IUPAC name is (2R)-1-(azetidin-1-yl)-2-[(6-but-3-enylpyrimidin-4-yl)amino]propan-1-one;trifluoromethanol.
| Compound Name | (2R)-1-(azetidin-1-yl)-2-[(6-but-3-enylpyrimidin-4-yl)amino]propan-1-one;trifluoromethanol |
|---|---|
| PubChem CID | 178126812 |
| Molecular Formula | C15H21F3N4O2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (2R)-1-(azetidin-1-yl)-2-[(6-but-3-enylpyrimidin-4-yl)amino]propan-1-one;trifluoromethanol |
| SMILES | C=CCCc1cc(N[C@H](C)C(=O)N2CCC2)ncn1.OC(F)(F)F |
| InChI | InChI=1S/C14H20N4O.CHF3O/c1-3-4-6-12-9-13(16-10-15-12)17-11(2)14(19)18-7-5-8-18;2-1(3,4)5/h3,9-11H,1,4-8H2,2H3,(H,15,16,17);5H/t11-;/m1./s1 |
| InChIKey | NGMOHKRXIHTTHX-RFVHGSKJSA-N |
| XLogP | 2.13 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|