C11H13F3N4O — CID 56862186
4-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperazin-2-one (PubChem CID 56862186) has the molecular formula C11H13F3N4O and a molecular weight of 274.25 g/mol. Its IUPAC name is 4-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperazin-2-one.
| Compound Name | 4-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperazin-2-one |
|---|---|
| PubChem CID | 56862186 |
| Molecular Formula | C11H13F3N4O |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperazin-2-one |
| SMILES | O=C1CN(c2nccc(CCC(F)(F)F)n2)CCN1 |
| InChI | InChI=1S/C11H13F3N4O/c12-11(13,14)3-1-8-2-4-16-10(17-8)18-6-5-15-9(19)7-18/h2,4H,1,3,5-7H2,(H,15,19) |
| InChIKey | FJHNDSZNIHOGHV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |