C12H15F3N4O — CID 56866993
3-[[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]amino]piperidin-2-one (PubChem CID 56866993) has the molecular formula C12H15F3N4O and a molecular weight of 288.27 g/mol. Its IUPAC name is 3-[[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]amino]piperidin-2-one.
| Compound Name | 3-[[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]amino]piperidin-2-one |
|---|---|
| PubChem CID | 56866993 |
| Molecular Formula | C12H15F3N4O |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 3-[[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]amino]piperidin-2-one |
| SMILES | O=C1NCCCC1Nc1nccc(CCC(F)(F)F)n1 |
| InChI | InChI=1S/C12H15F3N4O/c13-12(14,15)5-3-8-4-7-17-11(18-8)19-9-2-1-6-16-10(9)20/h4,7,9H,1-3,5-6H2,(H,16,20)(H,17,18,19) |
| InChIKey | WMLHKCYMVZFYSJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |