C10H13F3N4O — CID 56878331
(2R)-2-[[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]amino]propanamide (PubChem CID 56878331) has the molecular formula C10H13F3N4O and a molecular weight of 262.23 g/mol. Its IUPAC name is (2R)-2-[[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]amino]propanamide.
| Compound Name | (2R)-2-[[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]amino]propanamide |
|---|---|
| PubChem CID | 56878331 |
| Molecular Formula | C10H13F3N4O |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (2R)-2-[[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]amino]propanamide |
| SMILES | C[C@@H](Nc1nccc(CCC(F)(F)F)n1)C(N)=O |
| InChI | InChI=1S/C10H13F3N4O/c1-6(8(14)18)16-9-15-5-3-7(17-9)2-4-10(11,12)13/h3,5-6H,2,4H2,1H3,(H2,14,18)(H,15,16,17)/t6-/m1/s1 |
| InChIKey | BSXQGIARJZWPCX-ZCFIWIBFSA-N |
| XLogP | 1.26 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |