C16H25F3N4O2 — CID 178127059
(2R)-1-(azetidin-1-yl)-2-[(6-propylpyrimidin-4-yl)amino]propan-1-one;ethene;trifluoromethanol (PubChem CID 178127059) has the molecular formula C16H25F3N4O2 and a molecular weight of 362.40 g/mol. Its IUPAC name is (2R)-1-(azetidin-1-yl)-2-[(6-propylpyrimidin-4-yl)amino]propan-1-one;ethene;trifluoromethanol.
| Compound Name | (2R)-1-(azetidin-1-yl)-2-[(6-propylpyrimidin-4-yl)amino]propan-1-one;ethene;trifluoromethanol |
|---|---|
| PubChem CID | 178127059 |
| Molecular Formula | C16H25F3N4O2 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (2R)-1-(azetidin-1-yl)-2-[(6-propylpyrimidin-4-yl)amino]propan-1-one;ethene;trifluoromethanol |
| SMILES | C=C.CCCc1cc(N[C@H](C)C(=O)N2CCC2)ncn1.OC(F)(F)F |
| InChI | InChI=1S/C13H20N4O.C2H4.CHF3O/c1-3-5-11-8-12(15-9-14-11)16-10(2)13(18)17-6-4-7-17;1-2;2-1(3,4)5/h8-10H,3-7H2,1-2H3,(H,14,15,16);1-2H2;5H/t10-;;/m1../s1 |
| InChIKey | HNRPYVVOIRWORB-YQFADDPSSA-N |
| XLogP | 2.76 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|