C17H29N — CID 178127636
ethane;3-[(2-ethyl-5-propan-2-ylphenyl)methyl]azetidine (PubChem CID 178127636) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is ethane;3-[(2-ethyl-5-propan-2-ylphenyl)methyl]azetidine.
| Compound Name | ethane;3-[(2-ethyl-5-propan-2-ylphenyl)methyl]azetidine |
|---|---|
| PubChem CID | 178127636 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | ethane;3-[(2-ethyl-5-propan-2-ylphenyl)methyl]azetidine |
| SMILES | CC.CCc1ccc(C(C)C)cc1CC1CNC1 |
| InChI | InChI=1S/C15H23N.C2H6/c1-4-13-5-6-14(11(2)3)8-15(13)7-12-9-16-10-12;1-2/h5-6,8,11-12,16H,4,7,9-10H2,1-3H3;1-2H3 |
| InChIKey | HGLACNBFDCSDJA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |