C14H20FN — CID 84788099
3-[[5-(1-fluoroethyl)-2-methylphenyl]methyl]pyrrolidine (PubChem CID 84788099) has the molecular formula C14H20FN and a molecular weight of 221.32 g/mol. Its IUPAC name is 3-[[5-(1-fluoroethyl)-2-methylphenyl]methyl]pyrrolidine.
| Compound Name | 3-[[5-(1-fluoroethyl)-2-methylphenyl]methyl]pyrrolidine |
|---|---|
| PubChem CID | 84788099 |
| Molecular Formula | C14H20FN |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 3-[[5-(1-fluoroethyl)-2-methylphenyl]methyl]pyrrolidine |
| SMILES | Cc1ccc(C(C)F)cc1CC1CCNC1 |
| InChI | InChI=1S/C14H20FN/c1-10-3-4-13(11(2)15)8-14(10)7-12-5-6-16-9-12/h3-4,8,11-12,16H,5-7,9H2,1-2H3 |
| InChIKey | JIIDQLDDQHBPJH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |