C14H18F3NO — CID 178127803
1-benzyl-3-methyl-3-(2,2,2-trifluoroethoxy)pyrrolidine (PubChem CID 178127803) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is 1-benzyl-3-methyl-3-(2,2,2-trifluoroethoxy)pyrrolidine.
| Compound Name | 1-benzyl-3-methyl-3-(2,2,2-trifluoroethoxy)pyrrolidine |
|---|---|
| PubChem CID | 178127803 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 1-benzyl-3-methyl-3-(2,2,2-trifluoroethoxy)pyrrolidine |
| SMILES | CC1(OCC(F)(F)F)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C14H18F3NO/c1-13(19-11-14(15,16)17)7-8-18(10-13)9-12-5-3-2-4-6-12/h2-6H,7-11H2,1H3 |
| InChIKey | HIQYZWLXDQUHFU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |