C12H12IN5O — CID 178129004
1-cyclopropyl-5-[hydroxy-(3-iodo-1-methylpyrazol-4-yl)methyl]pyrazole-3-carbonitrile (PubChem CID 178129004) has the molecular formula C12H12IN5O and a molecular weight of 369.17 g/mol. Its IUPAC name is 1-cyclopropyl-5-[hydroxy-(3-iodo-1-methylpyrazol-4-yl)methyl]pyrazole-3-carbonitrile.
| Compound Name | 1-cyclopropyl-5-[hydroxy-(3-iodo-1-methylpyrazol-4-yl)methyl]pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 178129004 |
| Molecular Formula | C12H12IN5O |
| Molecular Weight | 369.17 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 1-cyclopropyl-5-[hydroxy-(3-iodo-1-methylpyrazol-4-yl)methyl]pyrazole-3-carbonitrile |
| SMILES | Cn1cc(C(O)c2cc(C#N)nn2C2CC2)c(I)n1 |
| InChI | InChI=1S/C12H12IN5O/c1-17-6-9(12(13)16-17)11(19)10-4-7(5-14)15-18(10)8-2-3-8/h4,6,8,11,19H,2-3H2,1H3 |
| InChIKey | IUNQRBDFPQDZSA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 79.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.17 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|