C21H32N4O2 — CID 178129415
1-cyclohexyl-6-[4-(dimethoxymethyl)piperidin-1-yl]benzimidazol-2-amine (PubChem CID 178129415) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 1-cyclohexyl-6-[4-(dimethoxymethyl)piperidin-1-yl]benzimidazol-2-amine.
| Compound Name | 1-cyclohexyl-6-[4-(dimethoxymethyl)piperidin-1-yl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 178129415 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 1-cyclohexyl-6-[4-(dimethoxymethyl)piperidin-1-yl]benzimidazol-2-amine |
| SMILES | COC(OC)C1CCN(c2ccc3nc(N)n(C4CCCCC4)c3c2)CC1 |
| InChI | InChI=1S/C21H32N4O2/c1-26-20(27-2)15-10-12-24(13-11-15)17-8-9-18-19(14-17)25(21(22)23-18)16-6-4-3-5-7-16/h8-9,14-16,20H,3-7,10-13H2,1-2H3,(H2,22,23) |
| InChIKey | NNANCCGBKLIMCW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|