About ethane;propan-2-yl 2-cyano-2-(6-cyano-5-ethylsulfanyl-3-pyridinyl)acetate
ethane;propan-2-yl 2-cyano-2-(6-cyano-5-ethylsulfanyl-3-pyridinyl)acetate (PubChem CID 178130219) has the molecular formula C16H21N3O2S
and a molecular weight of 319.43 g/mol. Its IUPAC name is ethane;propan-2-yl 2-cyano-2-(6-cyano-5-ethylsulfanyl-3-pyridinyl)acetate.
Molecular Properties
| Compound Name | ethane;propan-2-yl 2-cyano-2-(6-cyano-5-ethylsulfanyl-3-pyridinyl)acetate |
| PubChem CID | 178130219 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | ethane;propan-2-yl 2-cyano-2-(6-cyano-5-ethylsulfanyl-3-pyridinyl)acetate |
| SMILES | CC.CCSc1cc(C(C#N)C(=O)OC(C)C)cnc1C#N |
| InChI | InChI=1S/C14H15N3O2S.C2H6/c1-4-20-13-5-10(8-17-12(13)7-16)11(6-15)14(18)19-9(2)3;1-2/h5,8-9,11H,4H2,1-3H3;1-2H3 |
| InChIKey | ICWDMDSCHSJGRT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethane;propan-2-yl 2-cyano-2-(6-cyano-5-ethylsulfanyl-3-pyridinyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propan-2-yl 2-cyano-2-(6-cyano-5-ethylsulfanyl-3-pyridinyl)acetate?
The IUPAC name of ethane;propan-2-yl 2-cyano-2-(6-cyano-5-ethylsulfanyl-3-pyridinyl)acetate (CID 178130219) is ethane;propan-2-yl 2-cyano-2-(6-cyano-5-ethylsulfanyl-3-pyridinyl)acetate.
What is the SMILES notation for ethane;propan-2-yl 2-cyano-2-(6-cyano-5-ethylsulfanyl-3-pyridinyl)acetate?
The canonical SMILES for ethane;propan-2-yl 2-cyano-2-(6-cyano-5-ethylsulfanyl-3-pyridinyl)acetate is CC.CCSc1cc(C(C#N)C(=O)OC(C)C)cnc1C#N.
What is the InChIKey of ethane;propan-2-yl 2-cyano-2-(6-cyano-5-ethylsulfanyl-3-pyridinyl)acetate?
The InChIKey is ICWDMDSCHSJGRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O2S.C2H6/c1-4-20-13-5-10(8-17-12(13)7-16)11(6-15)14(18)19-9(2)3;1-2/h5,8-9,11H,4H2,1-3H3;1-2H3.
What are the key properties of ethane;propan-2-yl 2-cyano-2-(6-cyano-5-ethylsulfanyl-3-pyridinyl)acetate?
ethane;propan-2-yl 2-cyano-2-(6-cyano-5-ethylsulfanyl-3-pyridinyl)acetate has a molecular weight of 319.43 g/mol, XLogP of 3.65, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propan-2-yl 2-cyano-2-(6-cyano-5-ethylsulfanyl-3-pyridinyl)acetate is sourced from PubChem (CID 178130219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).