C21H21ClFN5O3 — CID 178131847
6-chloro-5-[4-[(3-ethyl-8-fluoro-2-oxo-1H-1,6-naphthyridin-7-yl)methyl]piperazin-1-yl]pyridine-2-carboxylic acid (PubChem CID 178131847) has the molecular formula C21H21ClFN5O3 and a molecular weight of 445.88 g/mol. Its IUPAC name is 6-chloro-5-[4-[(3-ethyl-8-fluoro-2-oxo-1H-1,6-naphthyridin-7-yl)methyl]piperazin-1-yl]pyridine-2-carboxylic acid.
| Compound Name | 6-chloro-5-[4-[(3-ethyl-8-fluoro-2-oxo-1H-1,6-naphthyridin-7-yl)methyl]piperazin-1-yl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 178131847 |
| Molecular Formula | C21H21ClFN5O3 |
| Molecular Weight | 445.88 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 6-chloro-5-[4-[(3-ethyl-8-fluoro-2-oxo-1H-1,6-naphthyridin-7-yl)methyl]piperazin-1-yl]pyridine-2-carboxylic acid |
| SMILES | CCc1cc2cnc(CN3CCN(c4ccc(C(=O)O)nc4Cl)CC3)c(F)c2[nH]c1=O |
| InChI | InChI=1S/C21H21ClFN5O3/c1-2-12-9-13-10-24-15(17(23)18(13)26-20(12)29)11-27-5-7-28(8-6-27)16-4-3-14(21(30)31)25-19(16)22/h3-4,9-10H,2,5-8,11H2,1H3,(H,26,29)(H,30,31) |
| InChIKey | URVYSHOENKANRS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.88 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|