C23H29FN6O3 — CID 178132130
5-[4-[(2-ethyl-5-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)methyl]piperazin-1-yl]-N',N'-dimethylpyridine-2-carbohydrazide (PubChem CID 178132130) has the molecular formula C23H29FN6O3 and a molecular weight of 456.52 g/mol. Its IUPAC name is 5-[4-[(2-ethyl-5-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)methyl]piperazin-1-yl]-N',N'-dimethylpyridine-2-carbohydrazide.
| Compound Name | 5-[4-[(2-ethyl-5-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)methyl]piperazin-1-yl]-N',N'-dimethylpyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 178132130 |
| Molecular Formula | C23H29FN6O3 |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 5-[4-[(2-ethyl-5-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)methyl]piperazin-1-yl]-N',N'-dimethylpyridine-2-carbohydrazide |
| SMILES | CCC1Oc2ccc(CN3CCN(c4ccc(C(=O)NN(C)C)nc4)CC3)c(F)c2NC1=O |
| InChI | InChI=1S/C23H29FN6O3/c1-4-18-23(32)26-21-19(33-18)8-5-15(20(21)24)14-29-9-11-30(12-10-29)16-6-7-17(25-13-16)22(31)27-28(2)3/h5-8,13,18H,4,9-12,14H2,1-3H3,(H,26,32)(H,27,31) |
| InChIKey | RXQTVEIHNBVBCP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|