C12H11FN2O2S — CID 178132863
2-(2-ethoxy-5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazole-5-carbaldehyde (PubChem CID 178132863) has the molecular formula C12H11FN2O2S and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(2-ethoxy-5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(2-ethoxy-5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 178132863 |
| Molecular Formula | C12H11FN2O2S |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-(2-ethoxy-5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazole-5-carbaldehyde |
| SMILES | CCOc1ncc(F)cc1-c1nc(C)c(C=O)s1 |
| InChI | InChI=1S/C12H11FN2O2S/c1-3-17-11-9(4-8(13)5-14-11)12-15-7(2)10(6-16)18-12/h4-6H,3H2,1-2H3 |
| InChIKey | XKLGLYUJHSZQIP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|