methyl (3R)-3-(4,4-difluorobutyl)piperidine-3-carboxylate

C11H19F2NO2 — CID 178133958

IUPACmethyl (3R)-3-(4,4-difluorobutyl)piperidine-3-carboxylate
SMILESCOC(=O)[C@]1(CCCC(F)F)CCCNC1
InChIInChI=1S/C11H19F2NO2/c1-16-10(15)11(5-2-4-9(12)13)6-3-7-14-8-11/h9,14H,2-8H2,1H3/t11-/m1/s1
InChIKeyBMDUOFYFKASBTL-LLVKDONJSA-N
MW235.27 g/mol
LogP1.96
Rot. Bonds5

About methyl (3R)-3-(4,4-difluorobutyl)piperidine-3-carboxylate

methyl (3R)-3-(4,4-difluorobutyl)piperidine-3-carboxylate (PubChem CID 178133958) has the molecular formula C11H19F2NO2 and a molecular weight of 235.27 g/mol. Its IUPAC name is methyl (3R)-3-(4,4-difluorobutyl)piperidine-3-carboxylate.

Molecular Properties

Compound Namemethyl (3R)-3-(4,4-difluorobutyl)piperidine-3-carboxylate
PubChem CID178133958
Molecular FormulaC11H19F2NO2
Molecular Weight235.27 g/mol
Exact Mass235.14
IUPAC Namemethyl (3R)-3-(4,4-difluorobutyl)piperidine-3-carboxylate
SMILESCOC(=O)[C@]1(CCCC(F)F)CCCNC1
InChIInChI=1S/C11H19F2NO2/c1-16-10(15)11(5-2-4-9(12)13)6-3-7-14-8-11/h9,14H,2-8H2,1H3/t11-/m1/s1
InChIKeyBMDUOFYFKASBTL-LLVKDONJSA-N
XLogP1.96
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.27
LogP ≤ 51.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl (3R)-3-(4,4-difluorobutyl)piperidine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (3R)-3-(4,4-difluorobutyl)piperidine-3-carboxylate?
The IUPAC name of methyl (3R)-3-(4,4-difluorobutyl)piperidine-3-carboxylate (CID 178133958) is methyl (3R)-3-(4,4-difluorobutyl)piperidine-3-carboxylate.
What is the SMILES notation for methyl (3R)-3-(4,4-difluorobutyl)piperidine-3-carboxylate?
The canonical SMILES for methyl (3R)-3-(4,4-difluorobutyl)piperidine-3-carboxylate is COC(=O)[C@]1(CCCC(F)F)CCCNC1.
What is the InChIKey of methyl (3R)-3-(4,4-difluorobutyl)piperidine-3-carboxylate?
The InChIKey is BMDUOFYFKASBTL-LLVKDONJSA-N. The full InChI is InChI=1S/C11H19F2NO2/c1-16-10(15)11(5-2-4-9(12)13)6-3-7-14-8-11/h9,14H,2-8H2,1H3/t11-/m1/s1.
What are the key properties of methyl (3R)-3-(4,4-difluorobutyl)piperidine-3-carboxylate?
methyl (3R)-3-(4,4-difluorobutyl)piperidine-3-carboxylate has a molecular weight of 235.27 g/mol, XLogP of 1.96, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R)-3-(4,4-difluorobutyl)piperidine-3-carboxylate is sourced from PubChem (CID 178133958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).