C14H26F3NO3 — CID 178134243
[(3R,5S)-5-tert-butyl-3-(2,2,2-trifluoroethoxymethyl)piperidin-3-yl]-methoxymethanol (PubChem CID 178134243) has the molecular formula C14H26F3NO3 and a molecular weight of 313.36 g/mol. Its IUPAC name is [(3R,5S)-5-tert-butyl-3-(2,2,2-trifluoroethoxymethyl)piperidin-3-yl]-methoxymethanol.
| Compound Name | [(3R,5S)-5-tert-butyl-3-(2,2,2-trifluoroethoxymethyl)piperidin-3-yl]-methoxymethanol |
|---|---|
| PubChem CID | 178134243 |
| Molecular Formula | C14H26F3NO3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | [(3R,5S)-5-tert-butyl-3-(2,2,2-trifluoroethoxymethyl)piperidin-3-yl]-methoxymethanol |
| SMILES | COC(O)[C@@]1(COCC(F)(F)F)CNC[C@H](C(C)(C)C)C1 |
| InChI | InChI=1S/C14H26F3NO3/c1-12(2,3)10-5-13(7-18-6-10,11(19)20-4)8-21-9-14(15,16)17/h10-11,18-19H,5-9H2,1-4H3/t10-,11?,13-/m1/s1 |
| InChIKey | IKTUIRYPMGDWAJ-IAUSTGCCSA-N |
| XLogP | 2.17 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|