C32H37BrN4O6 — CID 178135282
N-[4-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-3-(4-bromophenyl)-1-phenylpyrazole-5-carboxamide (PubChem CID 178135282) has the molecular formula C32H37BrN4O6 and a molecular weight of 653.57 g/mol. Its IUPAC name is N-[4-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-3-(4-bromophenyl)-1-phenylpyrazole-5-carboxamide.
| Compound Name | N-[4-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-3-(4-bromophenyl)-1-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 178135282 |
| Molecular Formula | C32H37BrN4O6 |
| Molecular Weight | 653.57 g/mol |
| Exact Mass | 652.19 |
| IUPAC Name | N-[4-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-3-(4-bromophenyl)-1-phenylpyrazole-5-carboxamide |
| SMILES | NCCOCCOCCOCCOCCOc1ccc(NC(=O)c2cc(-c3ccc(Br)cc3)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H37BrN4O6/c33-26-8-6-25(7-9-26)30-24-31(37(36-30)28-4-2-1-3-5-28)32(38)35-27-10-12-29(13-11-27)43-23-22-42-21-20-41-19-18-40-17-16-39-15-14-34/h1-13,24H,14-23,34H2,(H,35,38) |
| InChIKey | VFTJVYWPBFNUTF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|