C19H17ClFN3O2 — CID 178138546
N-(4-tert-butylphenyl)-5-(2-chloro-3-pyridinyl)-4-fluoro-1,2-oxazole-3-carboxamide (PubChem CID 178138546) has the molecular formula C19H17ClFN3O2 and a molecular weight of 373.82 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-5-(2-chloro-3-pyridinyl)-4-fluoro-1,2-oxazole-3-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-5-(2-chloro-3-pyridinyl)-4-fluoro-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 178138546 |
| Molecular Formula | C19H17ClFN3O2 |
| Molecular Weight | 373.82 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-(4-tert-butylphenyl)-5-(2-chloro-3-pyridinyl)-4-fluoro-1,2-oxazole-3-carboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)c2noc(-c3cccnc3Cl)c2F)cc1 |
| InChI | InChI=1S/C19H17ClFN3O2/c1-19(2,3)11-6-8-12(9-7-11)23-18(25)15-14(21)16(26-24-15)13-5-4-10-22-17(13)20/h4-10H,1-3H3,(H,23,25) |
| InChIKey | IAAZRWBYPGYBIT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.82 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|