C17H28N2 — CID 178141279
N-methyl-N-(2-methylcyclohexyl)-5-(2-methylpropyl)pyridin-2-amine (PubChem CID 178141279) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is N-methyl-N-(2-methylcyclohexyl)-5-(2-methylpropyl)pyridin-2-amine.
| Compound Name | N-methyl-N-(2-methylcyclohexyl)-5-(2-methylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 178141279 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N-methyl-N-(2-methylcyclohexyl)-5-(2-methylpropyl)pyridin-2-amine |
| SMILES | CC(C)Cc1ccc(N(C)C2CCCCC2C)nc1 |
| InChI | InChI=1S/C17H28N2/c1-13(2)11-15-9-10-17(18-12-15)19(4)16-8-6-5-7-14(16)3/h9-10,12-14,16H,5-8,11H2,1-4H3 |
| InChIKey | ZKZVIHBQECPQAR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |