C16H27N3O2 — CID 102633012
2-[[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]-methylamino]cyclohexan-1-ol (PubChem CID 102633012) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-[[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]-methylamino]cyclohexan-1-ol.
| Compound Name | 2-[[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]-methylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102633012 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 2-[[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]-methylamino]cyclohexan-1-ol |
| SMILES | COCCNCc1ccc(N(C)C2CCCCC2O)nc1 |
| InChI | InChI=1S/C16H27N3O2/c1-19(14-5-3-4-6-15(14)20)16-8-7-13(12-18-16)11-17-9-10-21-2/h7-8,12,14-15,17,20H,3-6,9-11H2,1-2H3 |
| InChIKey | DYUOTZYVYBHDSQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|